Khác biệt giữa các bản “Kẹo mạch nha”

không có tóm lược sửa đổi
(bổ sung)
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477169233
| ImageFile = Maltose2.svg
| ImageSize =
| ImageName = α-Maltose
| ImageCaption = α-Maltose
| ImageFile1 = Maltose structure.svg
| ImageSize1 =
| ImageName1 = β-Maltose
| ImageCaption1 = β-Maltose
| IUPACName = 2-(hydroxymethyl)-6-[4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyox
ane-3,4,5-triol
| OtherNames = 4-''O''-α-<small>D</small>-Glucopyranosyl-<small>D</small>-glucose
|Section1={{Chembox Identifiers
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17306
| SMILES = O([C@H]1[C@H](O)[C@@H](O)C(O)O[C@@H]1CO)[C@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 66Y63L379N
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1234209
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11?,12-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GUBGYTABKSRVRQ-PICCSMPSSA-N
| ChemSpiderID1_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID1 = 6019
| ChemSpiderID1_Comment = β-maltose
| InChI = 1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8-,9-,10-,11?,12-/m1/s1
| InChIKey1 = GUBGYTABKSRVRQ-PICCSMPSSA-N
| CASNo = 69-79-4
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNoOther =
| EC_number = 200-716-5
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 388329
| ChemSpiderID_Comment = α-maltose
| PubChem = 6255
}}
|Section2={{Chembox Properties
| Properties_ref = <ref>{{RubberBible62nd|page=C-367}}.</ref>
| C=12 | H=22 | O=11
| Appearance = White powder or crystals
| Density = 1.54 g/cm<sup>3</sup>
| MeltingPtC = 160 to 165
| MeltingPt_notes = (anhydrous)<br />102–103&nbsp;°C (monohydrate)
| Solubility = 1.080 g/mL (20&nbsp;°C)
| SpecRotation = +140.7° (H<sub>2</sub>O, ''c'' = 10)
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.bme.utexas.edu/ugrad/UGLab/resources/MSDS/maltose.pdf External MSDS]
| AutoignitionPt =
}}
|Section8={{Chembox Related
| OtherFunction = [[Sucrose]]<br />[[Lactose]]<br />[[Trehalose]]<br />[[Cellobiose]]
}}
}}
[[Tập tin:Maltose syrup.jpg|nhỏ|phải|300px|Một bát đường mạch nha]]
{{ẩm thực}}
Người dùng vô danh