Khác biệt giữa các bản “Chụp cộng hưởng từ Dotarem”

không có tóm lược sửa đổi
(Tạo trang mới, bổ sung liên kết và chú thích nguồn)
 
 
== '''Sơ lược về Gadovist''' ==
''Italic text''{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 443831564
| IUPAC_name = gadolinium(III) 2,2',2<nowiki>''</nowiki>-(10-((2''R'',3''S'')-1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetate
| image = Gadobutrol skeletal.svg
 
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|gadobutrol}}
| licence_US = Gadavist
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = C
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = POM
| legal_US = Rx-only
| routes_of_administration = [[Intravenous therapy|IV]]
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 138071-82-6
| ATC_prefix = V08
| ATC_suffix = CA09
| PubChem = 72057
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB06703
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 68841
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1BJ477IO2L
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1628503
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07420
 
<!--Chemical data-->
| C=18 | H=31 | Gd=1 | N=4 | O=9
| molecular_weight = 604.710 g/mol
| smiles = C1CN(CCN(CCN(CCN1CC(=O)[O-])CC(=O)[O-])C(CO)C(CO)O)CC(=O)[O-].[Ga+3]
}}
[[:en:Gadobutrol|Gadovist]] có dược chất là [[:en:Gadobutrol|Gadobutrol]] là một thuốc tương phản từ được tổ chức kiểm soát dược phẩm và thực phẩm Liên Minh Châu Âu, Canada. Hoa Kỳ cho phép sử dụng trong mục đích chẩn đoán bệnh lý con người. Năm 2007 Gadovist là thuốc tương phản từ duy nhất trên toàn thế giới được cho phép lưu hành với đồng độ 1mmol/1ml. Các kỹ thuật liên quan đến thuốc này được nghiên cứu và phát triển bởi Bayer HealthCare Pharmaceuticals, giúp cho các bác sĩ có thể chẩn đoán được bệnh lý một cách chính xác và dễ dàng hơn <ref>{{Chú thích web|url=http://news.zing.vn/Chup-cong-huong-tu-co-gay-nguy-hiem-khong-post580426.html|title=}}</ref>.
 
213

lần sửa đổi