Khác biệt giữa bản sửa đổi của “Natri dichloroisocyanurat”
Nội dung được xóa Nội dung được thêm vào
Tạo với bản dịch của trang “Sodium dichloroisocyanurate” |
Không có tóm lược sửa đổi |
||
Dòng 1:
{{chembox new
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 476994929
| ImageFile = Sodium dichloroisocyanurate structure.svg
| ImageSize = 150px
| IUPACName = Natri 3,5-diclo-2,4,6-trioxo-1,3,5-triazinan-1-id
| OtherNames = Natri dicloisocyanurat, Natri troclosene, Sodic troclosene
|Section1={{Chembox Identifiers
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 451165
| InChI = 1S/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1
| InChIKey = MSFGZHUJTJBYFA-REWHXWOFAV
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C3HCl2N3O3.Na/c4-7-1(9)6-2(10)8(5)3(7)11;/h(H,6,9,10);/q;+1/p-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = MSFGZHUJTJBYFA-UHFFFAOYSA-M
| InChIKey1 = MSFGZHUJTJBYFA-UHFFFAOYSA-M
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 2893-78-9
| CASNo2_Ref = {{cascite|changed|??}}
| CASNo2 = 51580-86-0
| CASNo2_Comment = (dihydrat)
| EINECS =
| PubChem = 517121
| SMILES = [Na+].ClN1C(=O)[N-]C(=O)N(Cl)C1=O
| RTECS = XZ1900000
| MeSHName =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
}}
|Section2={{Chembox Properties
| Formula = C<sub>3</sub>Cl<sub>2</sub>N<sub>3</sub>NaO<sub>3</sub>
| MolarMass = 219.95 g/mol (khan)<br />
255.98 g/mol (dihydrat)
| Appearance = bột tinh thể màu trắng
| Odor = có mùi clo
| Density = 0.7 g/cm<sup>3</sup> (dạng hạt nhỏ)
| MeltingPtC = 225
| MeltingPt_notes =
| BoilingPt =
| BoilingPt_notes =
| Solubility = 22.7 g/100 mL (25 °C)
| Solvent1 = aceton
| Solubility1 = 0.5 g/100 mL (30 °C)
| SolubleOther =
| Solvent =
| pKa = 6.2-6.8
| pKb =
}}
|Section7={{Chembox Hazards
| LD50 = (chuột, đường uống) 1670 mg/kg
| EUClass =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-S =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| AutoignitionPt =
| ExploLimits =
| PEL = }}
|Section8={{Chembox Related
| OtherCations = [[Kali dicloisocyanurat]]<br />[[Canxi dicloisocyanurat]]<br />[[Liti dicloisocyanurat]]<br />[[Bari dicloisocyanurat]]
}}
}}
'''Natri dicloisocyanurat''' (INN: natri troclosene, ''troclosenum natricum'' hay NaDCC hay SDIC) là một [[Hợp chất|hợp chất hóa học]] được dùng rộng rãi làm chất tẩy uế và thuốc tẩy.<ref name="Ullmann">{{Chú thích sách|doi=10.1002/14356007.a08_191|chapter=Cyanuric Acid and Cyanuric Chloride|title=Ullmann's Encyclopedia of Industrial Chemistry|year=2000|last1=Huthmacher|first1=Klaus|last2=Most|first2=Dieter|isbn=3-527-30673-0|publisher=Wiley-VCH|location=Weinheim}}</ref> Nó là một chất rắn không màu, tan trong nước. Ngoài ra còn có dạng dihydrat ({{CAS|51580-86-0}}) cũng như dạng muối kali ({{CAS|2244-21-5}}).
Hàng 14 ⟶ 86:
<references />
[[Thể loại:Hợp chất natri]]
{{Hợp chất natri}}
| |||