Khác biệt giữa bản sửa đổi của “Kali dichromat”
Nội dung được xóa Nội dung được thêm vào
Tạo với bản dịch của trang “Potassium dichromate” |
|||
Dòng 1:
{{Distinguish|Kali cromat}}
{{chembox
| verifiedrevid = 406377229
| Name = Kali dicromat
| ImageFile = Potassium-dichromate-sample.jpg
| ImageName = Potassium dichromate
| ImageFile1 = Potassium-dichromate-unit-cell-3D-balls.png
| ImageName1 = Khung mô hình kali dicromat
| IUPACName = Potassium dichromate(VI)
| OtherNames =
potassium bichromate<br>
bichromate of potash<br>
dipotassium dichromate<br>
dichromic acid, dipotassium salt<br>
chromic acid, dipotassium salt<br>
[[lopezite]]<ref>{{cite web|url=http://www.epa.gov/osw/hazard/wastetypes/wasteid/inorchem/docs/pot-dich.pdf|title=POTASSIUM DICHROMATE LISTING|publisher=US EPA}}</ref>
|Section1={{Chembox Identifiers
| CASNo = 7778-50-9
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 22910
| ChEMBL = 1374101
| SMILES = [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI =1S/2Cr.2K.7O/q;;2*+1;;;;;;2*-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KMUONIBRACKNSN-UHFFFAOYSA-N
| PubChem = 24502
| EINECS = 231-906-6
| RTECS = HX7680000
| UNNumber = 3288
}}
|Section2={{Chembox Properties
| Formula = K<sub>2</sub>Cr<sub>2</sub>O<sub>7</sub>
| MolarMass = 294.185 g/mol
| Appearance = red-orange crystalline solid
| Odor = odorless
| Density = 2.676 g/cm<sup>3</sup>, solid
| Solubility = 4.9 g/100 mL (0 °C) <br> 13 g/100 mL (20 °C) <br> 102 g/100 mL (100 °C)
| SolubleOther = insoluble in [[alcohol]], [[acetone]].
| MeltingPtC = 398
| BoilingPtC = 500
| BoilingPt_notes = decomposes
| RefractIndex = 1.738
}}
|Section3={{Chembox Structure
| Coordination = [[Tetrahedral]] (for Cr)
| CrystalStruct = [[Triclinic]] (α-form, <241.6 °C)
}}
|Section4={{Chembox Thermochemistry
| DeltaHf = -2033 kJ/mol
| Entropy = 291.2 J K<sup>−1</sup> mol<sup>−1</sup>
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics1371.htm ICSC 1371]
| EUClass = Oxidant ('''O''')<br />[[Carcinogen|Carc. Cat. 2]]<br />[[Mutagen|Muta. Cat. 2]]<br />Repr. Cat. 2<br />Highly toxic ('''T+''')<br />Harmful ('''Xn''')<br />Corrosive ('''C''')<br />Dangerous for the environment ('''N''')
| RPhrases = {{R45}}, {{R46}}, {{R60}}, {{R61}}, {{R8}}, {{R21}}, {{R25}}, {{R26}}, {{R34}}, {{R42/43}}, {{R48/23}}, {{R50/53}}
| SPhrases = {{S53}}, {{S45}}, {{S60}}, {{S61}}
| NFPA-H = 4
| NFPA-F = 0
| NFPA-R = 1
| NFPA-S = OX
| FlashPt = non-flammable
| LD50 = 25 mg/kg (oral, rat)<ref>{{cite web|url=http://chem.sis.nlm.nih.gov/chemidplus/rn/7778-50-9|title=ChemIDplus - 7778-50-9 - KMUONIBRACKNSN-UHFFFAOYSA-N - Potassium dichromate - Similar structures search, synonyms, formulas, resource links, and other chemical information.|first=Michael|last=Chambers|publisher=}}</ref>
}}
|Section8={{Chembox Related
| OtherAnions = [[Potassium chromate]]<br />[[Potassium molybdate]]<br />[[Potassium tungstate]]
| OtherCations = [[Ammonium dichromate]]<br />[[Sodium dichromate]]
| OtherCompounds = [[Potassium permanganate]]
}}
}}
'''Kali dicromat''', K<sub>2</sub>Cr<sub>2</sub>O<sub>7</sub>, là một [[hợp chất]] phản ứng hóa học vô cơ phổ biến, thường được sử dụng như là một [[chất oxy hóa]] trong các ứng dụng phòng thí nghiệm và công nghiệp khác nhau. Như với tất cả các hợp chất crôm hóa trị +6, chất này cực kỳ có hại cho sức khỏe. Kali dicromat là một chất rắn tinh thể với màu đỏ-cam nổi bật. Muối này khá phổ biến trong phòng thí nghiệm vì nó không chảy nước, ngược lại với loại muối tương tự [[Natri đicromat|natri dicromat]] phổ biến hơn trong công nghiệp.<ref name="Ullmann">Gerd Anger, Jost Halstenberg, Klaus Hochgeschwender, Christoph Scherhag, Ulrich Korallus, Herbert Knopf, Peter Schmidt, Manfred Ohlinger, "Chromium Compounds" in Ullmann's Encyclopedia of Industrial Chemistry, Wiley-VCH, Weinheim, 2005. {{DOI|10.1002/14356007.a07_067}}</ref>
| |||