Khác biệt giữa bản sửa đổi của “Stronti nitrat”
Nội dung được xóa Nội dung được thêm vào
fix ref |
|||
Dòng 1:
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477000320
| ImageFile = strontium nitrate.png
| ImageSize = 150px
| IUPACName = Strontium nitrate
| OtherNames =
|Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23231
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = BDG873AQZL
| InChI = 1/2NO3.Sr/c2*2-1(3)4;/q2*-1;+2
| InChIKey = DHEQXMRUPNDRPG-UHFFFAOYAG
| SMILES = [Sr+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/2NO3.Sr/c2*2-1(3)4;/q2*-1;+2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = DHEQXMRUPNDRPG-UHFFFAOYSA-N
| CASNo = 10042-76-9
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 24848
| EINECS = 233-131-9
}}
|Section2={{Chembox Properties
| Formula = Sr(NO<sub>3</sub>)<sub>2</sub>
| MolarMass = 211.630 g/mol (anhydrous) <br> 283.69 g/mol (tetrahydrate)
| Appearance = white granular solid
| Density = 2.986 g/cm<sup>3</sup> (anhydrous) <br> 2.20 g/cm<sup>3</sup> (tetrahydrate)<ref>Patnaik, Pradyot (2002). ''Handbook of Inorganic Chemicals''. McGraw-Hill, {{ISBN|0-07-049439-8}}</ref>
| MeltingPtC = 570
| MeltingPt_notes = (anhydrous) <br> 100 °C, decomposes (tetrahydrate)
| BoilingPtC = 645
| BoilingPt_notes = decomposes
| Solubility = ''anhydrous:'' <br> 710 g/L (18 °C) <br> 660 g/L (20 °C) <hr> ''tetrahydrate:'' <br> 604.3 g/L (0 °C) <br> 2065 g/L (100 °C)
| SolubleOther = soluble in [[ammonia]] <br> very slightly soluble in [[ethanol]], [[acetone]] <br> insoluble in [[nitric acid]]
| MagSus = −57.2·10<sup>−6</sup> cm<sup>3</sup>/mol
}}
|Section3={{Chembox Structure
| CrystalStruct = cubic (anhydrous) <br> monoclinic (tetrahydrate)
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.sciencelab.com/msds.php?msdsId=9927283]
| MainHazards = Irritant
| NFPA-H = 2
| NFPA-F = 0
| NFPA-R = 0
| NFPA-S =
| FlashPt = Non-flammable
| LD50 = 2750 mg/kg (rat, oral)
}}
|Section8={{Chembox Related
| OtherAnions = [[Strontium sulfate]]<br/>[[Strontium chloride]]
| OtherCations = [[Beryllium nitrate]]<br/>[[Magnesium nitrate]]<br/>[[Calcium nitrate]]<br/>[[Barium nitrate]]
}}
}}
'''Stronti nitrat''' là một [[hợp chất vô cơ]] được cấu thành từ [[stronti]] và [[nitơ]] với [[công thức hóa học]] [[Stronti|Sr]]([[Nitrat|NO<sub>3</sub>]])<sub>2</sub>. Chất rắn không màu này được sử dụng như một chất tạo màu đỏ trong pháo hoa và cũng được sử dụng làm chất oxy hóa trong công nghệ pháo hoa.
== Điều chế ==
[[Tập tin:Strontium_Carbonate_and_Nitric_acid.jpg|phải|nhỏ|Phản ứng của axit nitric và stronti cacbonat tạo thành stronti nitrat]]
Stronti nitrat thường được tạo ra bằng phản ứng của [[axit nitric]] on [[Strontium carbonate|stronti carbonat]].<ref name=
: 2 HNO<sub>3</sub> + SrCO<sub>3</sub> → Sr(NO<sub>3</sub>)<sub>2</sub> + [[Nước|H<sub>2</sub>O]] + [[Cacbon điôxít|CO<sub>2</sub>]]
== Ứng dụng ==
Giống như nhiều muối stronti khác, stronti nitrat được sử dụng để tạo ra ngọn lửa màu đỏ trong [[pháo hoa]] và pháo sáng trên đường bộ. Các tính chất oxy hoá của muối này tỏ ra thuận lợi trong các ứng dụng như vậy.<ref>MacMillan, J. Paul; Park, Jai Won; Gerstenberg, Rolf; Wagner, Heinz; Köhler, Karl and Wallbrecht, Peter (2002) "Strontium and Strontium Compounds" in ''Ullmann's Encyclopedia of Industrial Chemistry'', Wiley-VCH, Weinheim. {{DOI|10.1002/14356007.a25_321}}</ref>
Stronti nitrat có thể giúp loại bỏ và làm giảm các kích ứng da. Khi trộn với axit glycolic, stronti nitrat làm giảm cảm giác kích ứng da tốt hơn đáng kể so với sử dụng một mình axit glycolic.<ref name=
== References ==
|