Khác biệt giữa bản sửa đổi của “Calci gluconat”

Nội dung được xóa Nội dung được thêm vào
Tạo với bản dịch của trang “Calcium gluconate
 
Dòng 1:
{{Infobox drug
'''Canxi gluconat''' là một is chất bổ sung khoáng chất kiêm thuốc. Với tư cách là thuốc nó được tiêm ven để chữa [[hạ canxi máu]], [[tăng kali máu]], và [[nhiễm độc magie]]. Việc sử dụng với tư cách bổ sung khoáng chất nói chung chỉ được yêu cầu khi không có đủ [[canxi]] trong chế độ ăn uống.<ref name="WHO2008">{{cite book|title=WHO Model Formulary 2008|date=2009|publisher=World Health Organization|isbn=9789241547659|page=497|url=http://apps.who.int/medicinedocs/documents/s16879e/s16879e.pdf|accessdate=8 January 2017|deadurl=no|archiveurl=https://web.archive.org/web/20161213060118/http://apps.who.int/medicinedocs/documents/s16879e/s16879e.pdf|archivedate=13 December 2016|df=}}</ref> Bổ sung khoáng chất có thể được sử dụng để điều trị hoặc ngăn ngừa [[loãng xương]] hay [[còi xương]]. Nó có thể uống qua miệng nhưng không nên [[tiêm bắp thịt]].<ref name="AHFS2017">{{cite web|title=Calcium Salts|url=https://www.drugs.com/monograph/calcium-salts.html|publisher=The American Society of Health-System Pharmacists|accessdate=8 January 2017|deadurl=no|archiveurl=https://web.archive.org/web/20170118041341/https://www.drugs.com/monograph/calcium-salts.html|archivedate=18 January 2017|df=}}</ref>
| drug_name =
| INN =
| type =<!-- empty -->
| IUPAC_name = calcium (2''R'',3''S'',4''R'',5''R'')- 2,3,4,5,6-pentahydroxyhexanoate
| image = Calcium gluconate.svg
| width =
| alt =
| image2 = Calcium gluconate ball-and-stick.png
| width2 =
| alt2 =
| imageL =
| widthL =
| altL =
| imageR =
| widthR =
| altR =
| caption =
<!-- Clinical data -->
| pronounce = KAL see um GLUE koe nate
| tradename =
| Drugs.com = {{Drugs.com|monograph|calcium-salts}}
| MedlinePlus =
| licence_EU = <!-- EMA requires brand name -->
| licence_US = <!-- FDA may use generic name -->
| DailyMedID = <!-- preference to licence_US -->
| pregnancy_AU = <!-- A/B1/B2/B3/C/D/X -->
| pregnancy_AU_comment =
| pregnancy_US = A
| pregnancy_US_comment = and C
| pregnancy_category=
| dependency_liability =
| addiction_liability =
| routes_of_administration = by mouth, IV, topical
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_AU_comment =
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA_comment =
| legal_DE = <!-- Anlage I, II, III or Unscheduled-->
| legal_DE_comment =
| legal_NZ = <!-- Class A, B, C -->
| legal_NZ_comment =
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C -->
| legal_UK_comment =
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US_comment =
| legal_UN = <!-- N I, II, III, IV / P I, II, III, IV-->
| legal_UN_comment =
| legal_status = <!--For countries not listed above-->
<!-- Pharmacokinetic data -->
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
<!-- Identifiers -->
| CAS_number = 299-28-5
| CAS_supplemental =
| class =
| ATCvet =
| ATC_prefix = A12
| ATC_suffix = AA03
| ATC_supplemental = {{ATC|D11|AX03}}
| PubChem = 9290
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 8932
| UNII = SQE6VB453K
| KEGG =
| ChEBI =
| ChEMBL =
| NIAID_ChemDB =
| synonyms =
<!-- Chemical and physical data -->
| chemical_formula =
| C=12
| H=22
| Ag=
| Al=
| As=
| Au=
| B=
| Bi=
| Br=
| Ca=1
| Cl=
| Co=
| F=
| Fe=
| Gd=
| I=
| K=
| Li=
| Mg=
| Mn=
| N=
| Na=
| O=14
| P=
| Pt=
| S=
| Sb=
| Se=
| Sr=
| Tc=
| Zn=
| charge=
| molecular_weight = 430.373
| SMILES = [Ca+2].[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[O-]C(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
| Jmol =
| StdInChI = 1S/2C6H12O7.Ca/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NEEHYRZPVYRGPP-IYEMJOQQSA-L
| density =
| density_notes =
| melting_point = 120
| melting_high =
| melting_notes = (decomposes)
| boiling_point =
| boiling_notes =
| solubility = slowly soluble
| specific_rotation =
}}
'''Canxi gluconat''' là một is chất bổ sung khoáng chất kiêm thuốc. Với tư cách là thuốc nó được tiêm ven để chữa [[hạ canxi máu]], [[tăng kali máu]], và [[nhiễm độc magie]]<ref name=BNF69/><ref name=AHFS2017/>. Việc sử dụng với tư cách bổ sung khoáng chất nói chung chỉ được yêu cầu khi không có đủ [[canxi]] trong chế độ ăn uống.<ref name="WHO2008">{{cite book|title=WHO Model Formulary 2008|date=2009|publisher=World Health Organization|isbn=9789241547659|page=497|url=http://apps.who.int/medicinedocs/documents/s16879e/s16879e.pdf|accessdate=8 January 2017|deadurl=no|archiveurl=https://web.archive.org/web/20161213060118/http://apps.who.int/medicinedocs/documents/s16879e/s16879e.pdf|archivedate=13 December 2016|df=}}</ref> Bổ sung khoáng chất có thể được sử dụng để điều trị hoặc ngăn ngừa [[loãng xương]] hay [[còi xương]]. Nó có thể uống qua miệng nhưng không nên [[tiêm bắp thịt]].<ref name="AHFS2017">{{cite web|title=Calcium Salts|url=https://www.drugs.com/monograph/calcium-salts.html|publisher=The American Society of Health-System Pharmacists|accessdate=8 January 2017|deadurl=no|archiveurl=https://web.archive.org/web/20170118041341/https://www.drugs.com/monograph/calcium-salts.html|archivedate=18 January 2017|df=}}</ref>
 
Tác dụng phụ khi tiêm bao gồm nhịp tim chậm, đau ở chỗ chích, và [[huyết áp thấp]].<ref name="WHO2008" /> Khi uống qua miệng các tác dụng phụ có thể bao gồm [[táo bón]] và [[buồn nôn]].<ref name="AHFS2017" /> Nên đo lượng canxi trong máu khi sử dụng và cần được chăm sóc đặc biệt ở những người có tiền sử [[sỏi thận]].<ref name="WHO2008" /> Ở liều bình thường sử dụng được coi là an toàn trong [[Thai nghén|thai kỳ]] và [[Nuôi con bằng sữa mẹ|khi cho con bú]].<ref name="AHFS2017" /><ref>{{cite web|title=Calcium gluconate Use During Pregnancy {{!}} Drugs.com|url=https://www.drugs.com/pregnancy/calcium-gluconate.html|website=www.drugs.com|accessdate=15 January 2017|deadurl=no|archiveurl=https://web.archive.org/web/20170118043743/https://www.drugs.com/pregnancy/calcium-gluconate.html|archivedate=18 January 2017|df=}}</ref> Canxi gluconat được sản xuất bằng cách trộn [[axit gluconic]] với [[canxi cacbonat]] hoặc [[canxi hydroxit]].<ref>{{cite book|last1=Bhattacharya|first1=Suvendu|title=Conventional and Advanced Food Processing Technologies|date=2014|publisher=John Wiley & Sons|isbn=9781118406304|page=391|url=https://books.google.com/books?id=_JSlBAAAQBAJ&pg=PA391|language=en|deadurl=no|archiveurl=https://web.archive.org/web/20170918185033/https://books.google.com/books?id=_JSlBAAAQBAJ&pg=PA391|archivedate=2017-09-18|df=}}</ref>
 
Canxi gluconat được sử dụng trong y tế trong những năm 1920.<ref>{{cite book|last1=Tegethoff|first1=F. Wolfgang|title=Calcium Carbonate: From the Cretaceous Period into the 21st Century|date=2012|publisher=Birkhäuser|isbn=9783034882453|page=308|url=https://books.google.com/books?id=eSMGCAAAQBAJ&pg=PA308|language=en|deadurl=no|archiveurl=https://web.archive.org/web/20170918185033/https://books.google.com/books?id=eSMGCAAAQBAJ&pg=PA308|archivedate=2017-09-18|df=}}</ref> Nó nằm trong [[Danh sách các thuốc thiết yếu của WHO]], gồm các thuốc hiệu quả và an toàn nhất trong [[hệ thống y tế]].<ref name="WHO19th">{{Chú thích web|url=http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|title=WHO Model List of Essential Medicines (19th List)|date=April 2015|accessdate=8 December 2016|website=World Health Organization|archiveurl=https://web.archive.org/web/20161213052708/http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|archivedate=13 December 2016|deadurl=no}}</ref> Canxi gluconat được bán như [[thuốc gốc]].<ref name=BNF69>{{cite book|title=British national formulary : BNF 69|date=2015|publisher=British Medical Association|isbn=9780857111562|pages=680, 694|edition=69}}</ref> Giá bán buôn thuốc nay tại các [[nước đang phát triển]] vào khoảng 0.21 tới 1.34 USD trên một gam liều dùng, 10 ml với nồng độ 100&nbsp;mg/ml (dung dịch nồng độ 10%).<ref name="ERC2014">{{Chú thích web|url=http://erc.msh.org/dmpguide/resultsdetail.cfm?language=english&code=CAL1A&s_year=2014&year=2014&str=100%20mg%2Fml&desc=Calcium%20Gluconate&pack=new&frm=AMPOULE&rte=INJ&class_code2=27%2E&supplement=&class_name=%2827%2E%29Vitamins%20and%20minerals%3Cbr%3E|title=Calcium Gluconate|accessdate=8 December 2016|website=International Drug Price Indicator Guide}}</ref> Tại Anh liều dùng này tốn khoảng 0.65 bảng Anh.<ref name=BNF69/>
Canxi gluconat được sử dụng trong y tế trong những năm 1920.<ref>{{Chú thích sách|url=https://books.google.com/books?id=eSMGCAAAQBAJ&pg=PA308|isbn=9783034882453}}<code style="color:inherit; border:inherit; padding:inherit;">&#x7C;tựa đề=</code> trống hay bị thiếu ([[:en:Help:CS1 errors#citation_missing_title|trợ giúp]])
[[Thể loại:Trang có chú thích thiếu tựa đề]]
[[Thể loại:Trang có URL không tên trong chú thích]]</ref> Nó nằm trong [[Danh sách các thuốc thiết yếu của WHO]], gồm các thuốc hiệu quả và an toàn nhất trong [[hệ thống y tế]].<ref name="WHO19th">{{Chú thích web|url=http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|title=WHO Model List of Essential Medicines (19th List)|date=April 2015|accessdate=8 December 2016|website=World Health Organization|archiveurl=https://web.archive.org/web/20161213052708/http://www.who.int/medicines/publications/essentialmedicines/EML_2015_FINAL_amended_NOV2015.pdf?ua=1|archivedate=13 December 2016|deadurl=no}}</ref> Canxi gluconat được bán như [[thuốc gốc]].<ref name="BNF69">{{Chú thích sách|isbn=9780857111562}}<code style="color:inherit; border:inherit; padding:inherit;">&#x7C;tựa đề=</code> trống hay bị thiếu ([[:en:Help:CS1 errors#citation_missing_title|trợ giúp]])
[[Thể loại:Trang có chú thích thiếu tựa đề]]</ref> Giá bán buôn thuốc nay tại các [[nước đang phát triển]] vào khoảng 0.21 tới 1.34 USD trên một gam liều dùng, 10 ml với nồng độ 100&nbsp;mg/ml (dung dịch nồng độ 10%).<ref name="ERC2014">{{Chú thích web|url=http://erc.msh.org/dmpguide/resultsdetail.cfm?language=english&code=CAL1A&s_year=2014&year=2014&str=100%20mg%2Fml&desc=Calcium%20Gluconate&pack=new&frm=AMPOULE&rte=INJ&class_code2=27%2E&supplement=&class_name=%2827%2E%29Vitamins%20and%20minerals%3Cbr%3E|title=Calcium Gluconate|accessdate=8 December 2016|website=International Drug Price Indicator Guide}}</ref> Tại Anh liều dùng này tốn khoảng 0.65 bảng Anh.
 
== References ==