Khác biệt giữa các bản “Bakelite”

không có tóm lược sửa đổi
(Tạo với bản dịch của trang “Bakelite”)
 
{{Chembox
 
|ImageFile=3-D Structure of Bakelite.png
|ImageSize=
|ImageName=
|Section1={{Chembox Identifiers
| CASNo = 9003-35-4
| ChemSpiderID = none
| SMILES = Oc0ccccc0Cc0cc(C1)c(O)c(c0)Cc0c(O)ccc(c0)Cc0ccc(O)c(c0)Cc0c(O)ccc(c0)Cc0c(O)ccc(c0)Cc0c(O)c(C2)cc(c0)Cc0c(O)ccc(c0)Cc(c0O)cc2cc0Cc0cc(Cc2ccc(O)cc2)c(O)c(c0)Cc0c(O)ccc(c0)C1
}}
|Section2={{Chembox Properties
| Formula = (C<sub>6</sub>H<sub>6</sub>O·CH<sub>2</sub>O)<sub>n</sub>
| MolarMass = Variable
| Appearance = Brown solid
| Density = 1.3 g/cm<sup>3</sup><ref name=b1>{{cite book|author1=Laughton M A |author2=Say M G |title=Electrical Engineer's Reference Book|url=https://books.google.com/books?id=N9z8BAAAQBAJ&pg=SA1-PA21|date=2013|publisher=Elsevier|isbn=978-1-4831-0263-4|pages=1.21}}</ref>
| ThermalConductivity = 0.2 W/(m·K)<ref name=b1/>
| RefractIndex = 1.63<ref>{{cite book|author=Tickell, F. G. |title=The techniques of sedimentary mineralogy|url=https://archive.org/details/techniquesofsedi0000tick|url-access=registration |date=2011|publisher=Elsevier|isbn=978-0-08-086914-8|page=[https://archive.org/details/techniquesofsedi0000tick/page/57 57]}}</ref>
| MeltingPt =
| BoilingPt =
| Solubility =
}}|Section4={{Chembox Thermochemistry
| DeltaGf =
| DeltaHc =
| DeltaHf =
| Entropy =
| HeatCapacity = 0.92 kJ/(kg·K)<ref name=b1/>
}}
}}
'''Bakelite''' ( {{IPAc-en|ˈ|b|eɪ|k|əl|aɪ|t
}} {{Respell|BAY|kə|lyte}} ; đôi khi viết thành '''Baekelite)''' hoặc '''polyoxybenzylmethylenglycolanhydride''' là [[chất dẻo]] đầu tiên được làm từ các thành phần tổng hợp. Nó là một [[Nhựa nhiệt rắn|loại chất dẻo]] [[Phenol formaldehyde|phenol formaldehyd]] [[Nhựa nhiệt rắn|nhiệt]], được hình thành từ [[phản ứng ngưng tụ]] của [[phenol]] với [[formaldehyd]] . Nó được nhà hóa học người Mỹ gốc Bỉ [[Leo Hendrick Baekeland|Leo Baekeland]] ở [[Yonkers, New York]], chế tạo vào năm 1907.
 
Bakelite được Hiệp hội Hóa học Hoa Kỳ chỉ định là Mốc hóa học lịch sử quốc gia vào ngày 9 tháng 11 năm 1993 để công nhận tầm quan trọng của nó như là [[Chất dẻo|nhựa tổng hợp]] đầu tiên trên thế giới. <ref name="Landmark">{{Chú thích web|url=http://www.acs.org/content/acs/en/education/whatischemistry/landmarks/bakelite.html|tựa đề=Bakelite: The World's First Synthetic Plastic|tác giả=American Chemical Society National Historic Chemical Landmarks|ngày truy cập=February 23, 2015}}</ref>
 
==Tham khảo==
{{tham khảo|2}}
 
[[Thể loại:Điện môi]]
[[Thể loại:Vật liệu composite]]
223.257

lần sửa đổi