Khác biệt giữa các bản “Chụp cộng hưởng từ Dotarem”

Chỉnh sửa lại nội dung
(Chỉnh sửa lại nội dung)
| smiles = C1CN(CCN(CCN(CCN1CC(=O)[O-])CC(=O)[O-])C(CO)C(CO)O)CC(=O)[O-].[Ga+3]
}}
'''PhươngChụp phápcộng MRIhưởng từ Gadovist''' (MRI Gadovist) là tên chung cho một nhóm các phương pháp khảo sát [[Chụp cộng hưởng từ|cộng hưởng từ]] với Gadovist <ref>{{Chú thích web|url=http://www.benhhoc.com/thuoc/2406-Gadovist.html|title=}}</ref><ref>{{Chú thích web|url=http://suckhoedoisong.vn/nhung-dieu-can-biet-ve-chup-cong-huong-tu-n57812.html|title=}}</ref>.
 
== '''Sơ lược về Gadovist''' ==
213

lần sửa đổi