Khác biệt giữa bản sửa đổi của “Acid uric”

Nội dung được xóa Nội dung được thêm vào
n thêm liên kết thiếu
n replaced: . <ref → .<ref (2), → (27) using AWB
Dòng 1:
{{chembox new
| verifiedrevid = 401980221
| Name = Axit uric
| ImageFileL1_Ref = {{chemboximage|correct|??}}
| ImageFileL1 = Harnsäure_Ketoform.svg
| ImageSizeL1 = 150px
| ImageFileR1 = Uric_acid3D.png
| ImageSizeR1 = 120px
| IUPACName = 7,9-dihydro-1H-purine-<br/>2,6,8(3H)-trione
| OtherNames = 2,6,8 Trioxypurine
| Section1 = {{Chembox Identifiers
| EINECS = 200-720-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 268B43MJ25
| InChI = 1/C5H4N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h(H4,6,7,8,9,10,11,12)/f/h6-9H<ref>"Uric Acid." Biological Magnetic Resonance Data Bank. [http://www.bmrb.wisc.edu/metabolomics/gen_metab_summary_5.php?molName=uric_acid#INCHI Indicator Information] Retrieved on ngày 18 tháng 2 năm 2008.</ref>
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00366
| PubChem = 1175
| DrugBank = DB01696
| ChEBI = 62589
| SMILES = O=C1\C2=C(/NC(=O)N1)NC(=O)N2
| InChI1 = 1/C5H4N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h(H4,6,7,8,9,10,11,12)
| InChIKey1 = LEHOTFFKMJEONL-UHFFFAOYAN
| ChEMBL = 792
Dòng 28:
| StdInChIKey = LEHOTFFKMJEONL-UHFFFAOYSA-N
| CASNo = 69-93-2
| CASNo_Ref = {{cascite|correct|CAS}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 1142
| RTECS =
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>5</sub>H<sub>4</sub>N<sub>4</sub>O<sub>3</sub>
| MolarMass = 168g/mol
| Appearance = Tinh thể trắng
| Density = 1.87
| Solubility = Một chút
| MeltingPt =phân hủy lúc nung nóng
| BoilingPt = N/A
| pKa = 5.8
}}
}}
'''Axit uric''' là một [[hợp chất dị vòng]] của [[cacbon|cácbon]], [[nitơ]], [[ôxy|ôxi]], và [[hiđrô|hyđrô]] với [[công thức hóa học|công thức]] C<sub>5</sub>H<sub>4</sub>N<sub>4</sub>O<sub>3</sub>. Nó tạo thành các [[ion]] và [[muối]] được gọi là '''urat''' và '''axit urat''' như [[amoni acid urate]]. Axit uric được tạo thành trong cơ thể do quá trình thoái giáng các nhân purin. Sau đó chúng được hòa tan trong [[máu]] và đưa đến [[thận]] và thải ra ngoài qua [[nước tiểu]]. Axit uric tăng có thể do quá trình tăng cung cấp, tăng tạo hoặc giảm thải trừ axit uric qua thận hoặc cả hai quá trình này. Khi nồng độ axit uric tăng cao kéo dài trong [[máu]] có thể dẫ đến một dạng [[viêm khớp]] được biết đến với tên [[bệnh gút|bệnh gout]]. Các hạt lắng đọng trong và xung quanh các khớp dẫn đến hậu quả viêm, sưng và đau khớp, lắng đọng dưới da tạo nên các hạt tophi, có thể tạo [[sỏi thận]] và [[suy thận]].
==Hóa học ==
Axit uric lần đầu tiên được phân lập từ sỏi thận vào năm 1776 bởi nhà hóa học người Thụy Điển [[Carl Wilhelm Scheele]].<ref name="Scheele">{{cite journal|authorlink=Carl Wilhelm Scheele|last=Scheele|first=C. W.|title=Examen Chemicum Calculi Urinari|trans-title=A chemical examiniation of kidney stones|journal=Opuscula|date=1776|volume=2|page=73}}</ref>. Năm 1882, nhà hóa học [[người Ukraina]] [[Ivan Horbaczewski]] lần đầu tiên tổng hợp axit uric bằng cách nấu chảy [[urê]] bằng [[glycine]]. <ref>{{cite journal|first=Johann|last=Horbaczewski|date=1882|url=https://books.google.com/books?id=b448AAAAIAAJ&pg=PA796#v=onepage&q&f=false|title=Synthese der Harnsäure|trans-title=Synthesis of uric acid|journal=Monatshefte für Chemie und Verwandte Teile Anderer Wissenschaften|volume=3|pages=796–797}}</ref>
 
Axit uric thể hiện [[tautome]] lactam-lactim (cũng thường được mô tả là [[tautome keto–enol]]<ref name="LiebermanMarks2007">{{cite book |author1= Michael Lieberman |author2=Allan D. Marks |author3=Colleen M. Smith |author4= Dawn B. Marks |title= Marks' Essential Medical Biochemistry |url= https://books.google.com/books?id=MgqI-pfk45QC&pg=PA47 |year=2007 |publisher= Lippincott Williams & Wilkins |isbn= 978-0-7817-9340-7 |pages= 47–}}</ref>). Mặc dù dạng lactim dự kiến ​​sẽ có một số mức độ axit uric thơm kết tinh ở dạng lactam, <ref>{{cite journal |last1=Ringertz |first1=H. |title=The molecular and crystal structure of uric acid |journal=Acta Crystallographica |date=1 March 1966 |volume=20 |issue=3 |pages=397–403 |doi=10.1107/S0365110X66000914}}</ref> với [[hóa học tính toán]] cũng chỉ ra rằng tautome là ổn định nhất. <ref>{{cite journal |last1=Jiménez |first1=Verónica |last2=Alderete |first2=Joel B. |title=Theoretical calculations on the tautomerism of uric acid in gas phase and aqueous solution |journal=Journal of Molecular Structure: THEOCHEM |date=November 2005 |volume=755 |issue=1–3 |pages=209–214 |doi=10.1016/j.theochem.2005.08.001}}</ref> Axit uric là một [[axit lưỡng cực]] có [[pKa|p''K''<sub>a1</sub>]]&nbsp;=&nbsp;5.4 và p''K''<sub>a2</sub>&nbsp;=&nbsp;10.3,<ref>{{cite book|last=McCrudden|first=Francis H.|title=Uric Acid|publisher=BiblioBazaar|year=2008}}{{ISBN missing}}</ref>, do đó ở pH sinh lý, nó chủ yếu tồn tại dưới dạng ion urat đơn sắc.
 
==Tham khảo==