-1,7-dihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate

Paclitaxel
Các định danh
ECHA InfoCard100.127.725

| image = Taxol.svg | width = 250 | alt = | caption = | image2 = Taxol(Paclitaxel)3D.png | tradename = Taxol, tên khác | Drugs.com = Chuyên khảo | MedlinePlus = | licence_EU = yes | licence_US = | pregnancy_AU = | pregnancy_US = D | pregnancy_category = | legal_US = Rx-only | legal_status = | routes_of_administration = IV | bioavailability = 6.5% (đường miệng)[1] | protein_bound = 89 tới 98% | metabolism = Gan (CYP2C8CYP3A4) | elimination_half-life = 5.8 giờ | excretion = Phân và nước tiểu | CAS_number = 33069-62-4 | CAS_number_Ref = | ATC_prefix = L01 | ATC_suffix = CD01 | ATC_supplemental =
L01CD03 (paclitaxel poliglumex) | PubChem = 36314 | IUPHAR_ligand = 2770 | DrugBank = DB01229 | DrugBank_Ref =  ☑Y | ChemSpiderID = 10368587 | ChemSpiderID_Ref =  ☑Y | UNII = P88XT4IS4D | UNII_Ref =  ☑Y | KEGG = D00491 | KEGG_Ref =  ☑Y | ChEBI = 45863 | ChEBI_Ref =  ☑Y | ChEMBL = 428647 | ChEMBL_Ref =  KhôngN | PDB_ligand = TA1 | C = 47 | H = 51 | N = 1 | O = 14 | molecular_weight = 853.906 g/mol | SMILES = CC1=C2[C@@]([C@]([C@H]([C@@H]3[C@]4([C@H](OC4)C[C@@H]([C@]3(C(=O)[C@@H]2OC(=O)C)C)O)OC(=O)C)OC(=O)c5ccccc5)(C[C@@H]1OC(=O)[C@H](O)[C@@H](NC(=O)c6ccccc6)c7ccccc7)O)(C)C | StdInChI = 1S/C47H51NO14/c1-25-31(60-43(56)36(52)35(28-16-10-7-11-17-28)48-41(54)29-18-12-8-13-19-29)23-47(57)40(61-42(55)30-20-14-9-15-21-30)38-45(6,32(51)22-33-46(38,24-58-33)62-27(3)50)39(53)37(59-26(2)49)34(25)44(47,4)5/h7-21,31-33,35-38,40,51-52,57H,22-24H2,1-6H3,(H,48,54)/t31-,32-,33+,35-,36+,37+,38-,40-,45+,46-,47+/m0/s1 | StdInChIKey = RCINICONZNJXQF-MZXODVADSA-N | StdInChIKey_Ref =  ☑Y | StdInChI_Ref =  ☑Y | verifiedrevid = 458461737 | Verifiedfields = changed }}Paclitaxel (PTX), được bán dưới tên thương mại là Taxol cùng với một số các tên gọi khác, là một loại thuốc hóa trị liệu được sử dụng để điều trị một số loại ung thư.[2] Các dạng ung thư này bao gồm ung thư buồng trứng, ung thư vú, ung thư phổi, sarcoma Kaposi, ung thư cổ tử cungung thư tuyến tụy.[2] Thuốc được đưa vào cơ thể bằng cách tiêm vào tĩnh mạch.[2] Ngoài ra còn có một công thức ở dạng gắn kết albumin.[2]

Tác dụng phụ thường gặp bao gồm rụng tóc, ức chế tủy xương, tê, phản ứng dị ứng, đau cơ và tiêu chảy.[2] Các tác dụng phụ nghiêm trọng khác có thể có như các vấn đề về tim, tăng nguy cơ nhiễm trùngviêm phổi.[2] Có những lo ngại rằng sử dụng thuốc trong khi mang thai có thể gây dị tật bẩm sinh.[2][3] Paclitaxel thuộc họ thuốc taxane.[4] Chúng hoạt động bằng cách can thiệp với chức năng bình thường của vi ống trong quá trình phân chia tế bào.[2]

Paclitaxel lần đầu tiên được phân lập vào năm 1971 từ cây thủy tùng Thái Bình Dương và được chấp thuận cho sử dụng y tế vào năm 1993.[5][6] Nó nằm trong danh sách các thuốc thiết yếu của Tổ chức Y tế Thế giới, tức là nhóm các loại thuốc hiệu quả và an toàn nhất cần thiết trong một hệ thống y tế.[7] Chi phí bán buôn ở các nước đang phát triển là khoảng 7,06 đến 13,48 USD/lọ 100 mg.[8] Lượng thuốc này ở Anh mua bởi NHS với giá khoảng 66,85 bảng Anh.[9] Thuốc bây giờ được sản xuất bởi nuôi cấy tế bào.[6]

Chú thíchSửa đổi

  1. ^ Peltier, Sandra; Oger, Jean-Michel; Lagarce, Frédéric; Couet, William; Benoît, Jean-Pierre (2006). “Enhanced Oral Paclitaxel Bioavailability After Administration of Paclitaxel-Loaded Lipid Nanocapsules”. Pharmaceutical Research. 23 (6): 1243–50. doi:10.1007/s11095-006-0022-2. PMID 16715372.
  2. ^ a ă â b c d đ e “Paclitaxel”. The American Society of Health-System Pharmacists. Lưu trữ bản gốc ngày 14 tháng 9 năm 2017. Truy cập ngày 2 tháng 1 năm 2015.
  3. ^ Berveiller, Paul; Mir, Olivier (2012). “Taxanes during Pregnancy: Probably Safe, but Still to Be Optimized”. Oncology. 83 (4): 239–240. doi:10.1159/000341820.
  4. ^ Chang, Alfred E.; Ganz, Patricia A.; Hayes, Daniel F.; Kinsella, Timothy; Pass, Harvey I.; Schiller, Joan H.; Stone, Richard M.; Strecher, Victor (2007). Oncology: An Evidence-Based Approach (bằng tiếng Anh). Springer Science & Business Media. tr. 34. ISBN 9780387310565. Lưu trữ bản gốc ngày 21 tháng 12 năm 2016.
  5. ^ Fischer, Janos; Ganellin, C. Robin (2006). Analogue-based Drug Discovery (bằng tiếng Anh). John Wiley & Sons. tr. 512. ISBN 9783527607495. Lưu trữ bản gốc ngày 21 tháng 12 năm 2016.
  6. ^ a ă “Taxol® (NSC 125973)”. National Cancer Institute:. Lưu trữ bản gốc ngày 5 tháng 9 năm 2015. Truy cập ngày 14 tháng 2 năm 2016.Quản lý CS1: dấu chấm câu dư (liên kết) Wayback machine
  7. ^ “WHO Model List of Essential Medicines (19th List)” (PDF). World Health Organization. tháng 4 năm 2015. Lưu trữ (PDF) bản gốc ngày 13 tháng 12 năm 2016. Truy cập ngày 8 tháng 12 năm 2016.
  8. ^ “Paclitaxel”. International Drug Price Indicator Guide. Truy cập ngày 8 tháng 12 năm 2016.
  9. ^ British national formulary: BNF 69 (ấn bản 69). British Medical Association. 2015. tr. 623. ISBN 9780857111562.